C8H2F15N — CID 87889098
2,2,3,3,4,4,5,6,6-nonafluoro-1,5-bis(trifluoromethyl)cyclohexan-1-amine (PubChem CID 87889098) has the molecular formula C8H2F15N and a molecular weight of 397.08 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,6,6-nonafluoro-1,5-bis(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | 2,2,3,3,4,4,5,6,6-nonafluoro-1,5-bis(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 87889098 |
| Molecular Formula | C8H2F15N |
| Molecular Weight | 397.08 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 2,2,3,3,4,4,5,6,6-nonafluoro-1,5-bis(trifluoromethyl)cyclohexan-1-amine |
| SMILES | NC1(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C8H2F15N/c9-1(7(18,19)20)3(10,11)2(24,8(21,22)23)5(14,15)6(16,17)4(1,12)13/h24H2 |
| InChIKey | KFUYFDYYVDJFGF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.08 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|