C12F24 — CID 141474938
1,1,2,2,3,3,4,4,5-nonafluoro-5-(1,1,1,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptan-2-yl)cyclopentane (PubChem CID 141474938) has the molecular formula C12F24 and a molecular weight of 600.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5-nonafluoro-5-(1,1,1,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptan-2-yl)cyclopentane.
| Compound Name | 1,1,2,2,3,3,4,4,5-nonafluoro-5-(1,1,1,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptan-2-yl)cyclopentane |
|---|---|
| PubChem CID | 141474938 |
| Molecular Formula | C12F24 |
| Molecular Weight | 600.08 g/mol |
| Exact Mass | 599.96 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5-nonafluoro-5-(1,1,1,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptan-2-yl)cyclopentane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12F24/c13-1(3(15,16)6(21,22)7(23,24)4(1,17)18)2(14,11(31,32)33)5(19,20)8(25,26)9(27,28)10(29,30)12(34,35)36 |
| InChIKey | DPBOZKDNAHKBKJ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.08 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|