C14F26O — CID 141298295
1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoro-7-(1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorocycloheptyl)oxycycloheptane (PubChem CID 141298295) has the molecular formula C14F26O and a molecular weight of 678.10 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoro-7-(1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorocycloheptyl)oxycycloheptane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoro-7-(1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorocycloheptyl)oxycycloheptane |
|---|---|
| PubChem CID | 141298295 |
| Molecular Formula | C14F26O |
| Molecular Weight | 678.10 g/mol |
| Exact Mass | 677.95 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoro-7-(1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorocycloheptyl)oxycycloheptane |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(OC2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14F26O/c15-1(16)2(17,18)6(25,26)10(33,34)13(39,9(31,32)5(1,23)24)41-14(40)11(35,36)7(27,28)3(19,20)4(21,22)8(29,30)12(14,37)38 |
| InChIKey | DCTUUPJDJGXADE-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.10 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|