C5H3Cl2F5O — CID 154145783
1,1-dichloro-2,2,3,3,4-pentafluoro-4-methoxycyclobutane (PubChem CID 154145783) has the molecular formula C5H3Cl2F5O and a molecular weight of 244.97 g/mol. Its IUPAC name is 1,1-dichloro-2,2,3,3,4-pentafluoro-4-methoxycyclobutane.
| Compound Name | 1,1-dichloro-2,2,3,3,4-pentafluoro-4-methoxycyclobutane |
|---|---|
| PubChem CID | 154145783 |
| Molecular Formula | C5H3Cl2F5O |
| Molecular Weight | 244.97 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 1,1-dichloro-2,2,3,3,4-pentafluoro-4-methoxycyclobutane |
| SMILES | COC1(F)C(F)(F)C(F)(F)C1(Cl)Cl |
| InChI | InChI=1S/C5H3Cl2F5O/c1-13-5(12)2(6,7)3(8,9)4(5,10)11/h1H3 |
| InChIKey | SFVDKCOBEFNOSD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.97 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|