C6H2Cl4F6O — CID 154105678
1,1,2-trichloro-2-(chloromethoxy)-3,3,4,4,5,5-hexafluorocyclopentane (PubChem CID 154105678) has the molecular formula C6H2Cl4F6O and a molecular weight of 345.88 g/mol. Its IUPAC name is 1,1,2-trichloro-2-(chloromethoxy)-3,3,4,4,5,5-hexafluorocyclopentane.
| Compound Name | 1,1,2-trichloro-2-(chloromethoxy)-3,3,4,4,5,5-hexafluorocyclopentane |
|---|---|
| PubChem CID | 154105678 |
| Molecular Formula | C6H2Cl4F6O |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 343.88 |
| IUPAC Name | 1,1,2-trichloro-2-(chloromethoxy)-3,3,4,4,5,5-hexafluorocyclopentane |
| SMILES | FC1(F)C(F)(F)C(Cl)(Cl)C(Cl)(OCCl)C1(F)F |
| InChI | InChI=1S/C6H2Cl4F6O/c7-1-17-3(10)2(8,9)4(11,12)6(15,16)5(3,13)14/h1H2 |
| InChIKey | IJFSWGBLEZLKBA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|