C6H2ClF9O — CID 154377976
1-(chloromethoxy)-1,2,2,3,3,4,4,5,5-nonafluorocyclopentane (PubChem CID 154377976) has the molecular formula C6H2ClF9O and a molecular weight of 296.52 g/mol. Its IUPAC name is 1-(chloromethoxy)-1,2,2,3,3,4,4,5,5-nonafluorocyclopentane.
| Compound Name | 1-(chloromethoxy)-1,2,2,3,3,4,4,5,5-nonafluorocyclopentane |
|---|---|
| PubChem CID | 154377976 |
| Molecular Formula | C6H2ClF9O |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 1-(chloromethoxy)-1,2,2,3,3,4,4,5,5-nonafluorocyclopentane |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(OCCl)C1(F)F |
| InChI | InChI=1S/C6H2ClF9O/c7-1-17-6(16)4(12,13)2(8,9)3(10,11)5(6,14)15/h1H2 |
| InChIKey | PRFADJFAZYJRLR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|