C11H15BrClF5O — CID 154312425
1-bromo-1-chloro-2,2,3,3,4-pentafluoro-4-heptoxycyclobutane (PubChem CID 154312425) has the molecular formula C11H15BrClF5O and a molecular weight of 373.59 g/mol. Its IUPAC name is 1-bromo-1-chloro-2,2,3,3,4-pentafluoro-4-heptoxycyclobutane.
| Compound Name | 1-bromo-1-chloro-2,2,3,3,4-pentafluoro-4-heptoxycyclobutane |
|---|---|
| PubChem CID | 154312425 |
| Molecular Formula | C11H15BrClF5O |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 1-bromo-1-chloro-2,2,3,3,4-pentafluoro-4-heptoxycyclobutane |
| SMILES | CCCCCCCOC1(F)C(F)(F)C(F)(F)C1(Cl)Br |
| InChI | InChI=1S/C11H15BrClF5O/c1-2-3-4-5-6-7-19-11(18)8(12,13)9(14,15)10(11,16)17/h2-7H2,1H3 |
| InChIKey | HDBWHYUQAUNYFU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|