C10H13F7O — CID 56997371
1,1,2,2,3,3,4-heptafluoro-4-hexoxycyclobutane (PubChem CID 56997371) has the molecular formula C10H13F7O and a molecular weight of 282.20 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluoro-4-hexoxycyclobutane.
| Compound Name | 1,1,2,2,3,3,4-heptafluoro-4-hexoxycyclobutane |
|---|---|
| PubChem CID | 56997371 |
| Molecular Formula | C10H13F7O |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1,1,2,2,3,3,4-heptafluoro-4-hexoxycyclobutane |
| SMILES | CCCCCCOC1(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H13F7O/c1-2-3-4-5-6-18-10(17)8(13,14)7(11,12)9(10,15)16/h2-6H2,1H3 |
| InChIKey | AYCKEIOVBZUQRW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|