C12H15F11O4Si — CID 21080031
trimethoxy-[3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)oxypropyl]silane (PubChem CID 21080031) has the molecular formula C12H15F11O4Si and a molecular weight of 460.31 g/mol. Its IUPAC name is trimethoxy-[3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)oxypropyl]silane.
| Compound Name | trimethoxy-[3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)oxypropyl]silane |
|---|---|
| PubChem CID | 21080031 |
| Molecular Formula | C12H15F11O4Si |
| Molecular Weight | 460.31 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | trimethoxy-[3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)oxypropyl]silane |
| SMILES | CO[Si](CCCOC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F)(OC)OC |
| InChI | InChI=1S/C12H15F11O4Si/c1-24-28(25-2,26-3)6-4-5-27-12(23)10(19,20)8(15,16)7(13,14)9(17,18)11(12,21)22/h4-6H2,1-3H3 |
| InChIKey | KGDRVNVVENRUAE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|