C17H10Cl2F6O2 — CID 15702464
4-[2,2-dichloro-3,3,4,4,5,5-hexafluoro-1-(4-hydroxyphenyl)cyclopentyl]phenol (PubChem CID 15702464) has the molecular formula C17H10Cl2F6O2 and a molecular weight of 431.16 g/mol. Its IUPAC name is 4-[2,2-dichloro-3,3,4,4,5,5-hexafluoro-1-(4-hydroxyphenyl)cyclopentyl]phenol.
| Compound Name | 4-[2,2-dichloro-3,3,4,4,5,5-hexafluoro-1-(4-hydroxyphenyl)cyclopentyl]phenol |
|---|---|
| PubChem CID | 15702464 |
| Molecular Formula | C17H10Cl2F6O2 |
| Molecular Weight | 431.16 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 4-[2,2-dichloro-3,3,4,4,5,5-hexafluoro-1-(4-hydroxyphenyl)cyclopentyl]phenol |
| SMILES | Oc1ccc(C2(c3ccc(O)cc3)C(F)(F)C(F)(F)C(F)(F)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H10Cl2F6O2/c18-14(19)13(9-1-5-11(26)6-2-9,10-3-7-12(27)8-4-10)15(20,21)17(24,25)16(14,22)23/h1-8,26-27H |
| InChIKey | USUYYDMROWADLJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.16 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|