C10H5ClF6O — CID 154102426
1-(4-chlorophenyl)-2,2,3,3,4,4-hexafluorocyclobutan-1-ol (PubChem CID 154102426) has the molecular formula C10H5ClF6O and a molecular weight of 290.59 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2,3,3,4,4-hexafluorocyclobutan-1-ol.
| Compound Name | 1-(4-chlorophenyl)-2,2,3,3,4,4-hexafluorocyclobutan-1-ol |
|---|---|
| PubChem CID | 154102426 |
| Molecular Formula | C10H5ClF6O |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2,3,3,4,4-hexafluorocyclobutan-1-ol |
| SMILES | OC1(c2ccc(Cl)cc2)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H5ClF6O/c11-6-3-1-5(2-4-6)7(18)8(12,13)10(16,17)9(7,14)15/h1-4,18H |
| InChIKey | NVGALBHWWCEZIQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|