C11H5BrF8O — CID 15702483
1-(4-bromophenyl)-2,2,3,3,4,4,5,5-octafluorocyclopentan-1-ol (PubChem CID 15702483) has the molecular formula C11H5BrF8O and a molecular weight of 385.05 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,2,3,3,4,4,5,5-octafluorocyclopentan-1-ol.
| Compound Name | 1-(4-bromophenyl)-2,2,3,3,4,4,5,5-octafluorocyclopentan-1-ol |
|---|---|
| PubChem CID | 15702483 |
| Molecular Formula | C11H5BrF8O |
| Molecular Weight | 385.05 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 1-(4-bromophenyl)-2,2,3,3,4,4,5,5-octafluorocyclopentan-1-ol |
| SMILES | OC1(c2ccc(Br)cc2)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H5BrF8O/c12-6-3-1-5(2-4-6)7(21)8(13,14)10(17,18)11(19,20)9(7,15)16/h1-4,21H |
| InChIKey | KKRVIKGHUDDDGL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.05 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|