C15H13ClO — CID 60864070
2-(4-chlorophenyl)-1,3-dihydroinden-2-ol (PubChem CID 60864070) has the molecular formula C15H13ClO and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,3-dihydroinden-2-ol.
| Compound Name | 2-(4-chlorophenyl)-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 60864070 |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-(4-chlorophenyl)-1,3-dihydroinden-2-ol |
| SMILES | OC1(c2ccc(Cl)cc2)Cc2ccccc2C1 |
| InChI | InChI=1S/C15H13ClO/c16-14-7-5-13(6-8-14)15(17)9-11-3-1-2-4-12(11)10-15/h1-8,17H,9-10H2 |
| InChIKey | MABQEPBDXGLDJQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |