C11H7ClF4O2 — CID 88629041
[(1R)-1-(4-chlorophenyl)-2,2,3,3-tetrafluorocyclobutyl] formate (PubChem CID 88629041) has the molecular formula C11H7ClF4O2 and a molecular weight of 282.62 g/mol. Its IUPAC name is [(1R)-1-(4-chlorophenyl)-2,2,3,3-tetrafluorocyclobutyl] formate.
| Compound Name | [(1R)-1-(4-chlorophenyl)-2,2,3,3-tetrafluorocyclobutyl] formate |
|---|---|
| PubChem CID | 88629041 |
| Molecular Formula | C11H7ClF4O2 |
| Molecular Weight | 282.62 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | [(1R)-1-(4-chlorophenyl)-2,2,3,3-tetrafluorocyclobutyl] formate |
| SMILES | O=CO[C@@]1(c2ccc(Cl)cc2)CC(F)(F)C1(F)F |
| InChI | InChI=1S/C11H7ClF4O2/c12-8-3-1-7(2-4-8)9(18-6-17)5-10(13,14)11(9,15)16/h1-4,6H,5H2/t9-/m1/s1 |
| InChIKey | RLKQYCBMAQXOEC-SECBINFHSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|