C5BrClF8 — CID 70673702
1-bromo-1-chloro-2,2,3,3,4,4,5,5-octafluorocyclopentane (PubChem CID 70673702) has the molecular formula C5BrClF8 and a molecular weight of 327.40 g/mol. Its IUPAC name is 1-bromo-1-chloro-2,2,3,3,4,4,5,5-octafluorocyclopentane.
| Compound Name | 1-bromo-1-chloro-2,2,3,3,4,4,5,5-octafluorocyclopentane |
|---|---|
| PubChem CID | 70673702 |
| Molecular Formula | C5BrClF8 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 325.87 |
| IUPAC Name | 1-bromo-1-chloro-2,2,3,3,4,4,5,5-octafluorocyclopentane |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(Cl)(Br)C1(F)F |
| InChI | InChI=1S/C5BrClF8/c6-1(7)2(8,9)4(12,13)5(14,15)3(1,10)11 |
| InChIKey | NEQYWGFKQRYDSG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|