C7BrF11 — CID 23235262
1-bromo-2,2,3,3,4,5,5,6,6,7,7-undecafluorobicyclo[2.2.1]heptane (PubChem CID 23235262) has the molecular formula C7BrF11 and a molecular weight of 372.96 g/mol. Its IUPAC name is 1-bromo-2,2,3,3,4,5,5,6,6,7,7-undecafluorobicyclo[2.2.1]heptane.
| Compound Name | 1-bromo-2,2,3,3,4,5,5,6,6,7,7-undecafluorobicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 23235262 |
| Molecular Formula | C7BrF11 |
| Molecular Weight | 372.96 g/mol |
| Exact Mass | 371.90 |
| IUPAC Name | 1-bromo-2,2,3,3,4,5,5,6,6,7,7-undecafluorobicyclo[2.2.1]heptane |
| SMILES | FC1(F)C(F)(F)C2(Br)C(F)(F)C(F)(F)C1(F)C2(F)F |
| InChI | InChI=1S/C7BrF11/c8-1-3(10,11)2(9,6(16,17)4(1,12)13)7(18,19)5(1,14)15 |
| InChIKey | TWGVSTOVWVKKDK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.96 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|