C7HBrF10 — CID 23235261
1-bromo-2,2,3,3,5,5,6,6,7,7-decafluorobicyclo[2.2.1]heptane (PubChem CID 23235261) has the molecular formula C7HBrF10 and a molecular weight of 354.97 g/mol. Its IUPAC name is 1-bromo-2,2,3,3,5,5,6,6,7,7-decafluorobicyclo[2.2.1]heptane.
| Compound Name | 1-bromo-2,2,3,3,5,5,6,6,7,7-decafluorobicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 23235261 |
| Molecular Formula | C7HBrF10 |
| Molecular Weight | 354.97 g/mol |
| Exact Mass | 353.91 |
| IUPAC Name | 1-bromo-2,2,3,3,5,5,6,6,7,7-decafluorobicyclo[2.2.1]heptane |
| SMILES | FC1(F)C2C(F)(F)C(F)(F)C(Br)(C2(F)F)C1(F)F |
| InChI | InChI=1S/C7HBrF10/c8-5-2(9,10)1(3(11,12)6(5,15)16)4(13,14)7(5,17)18/h1H |
| InChIKey | DZWIKQHQBQPBLL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.97 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|