C6H2BrClF6 — CID 150511473
3-bromo-3-chloro-4,4,5,5,6,6-hexafluorocyclohexene (PubChem CID 150511473) has the molecular formula C6H2BrClF6 and a molecular weight of 303.43 g/mol. Its IUPAC name is 3-bromo-3-chloro-4,4,5,5,6,6-hexafluorocyclohexene.
| Compound Name | 3-bromo-3-chloro-4,4,5,5,6,6-hexafluorocyclohexene |
|---|---|
| PubChem CID | 150511473 |
| Molecular Formula | C6H2BrClF6 |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 301.89 |
| IUPAC Name | 3-bromo-3-chloro-4,4,5,5,6,6-hexafluorocyclohexene |
| SMILES | FC1(F)C=CC(Cl)(Br)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H2BrClF6/c7-3(8)1-2-4(9,10)6(13,14)5(3,11)12/h1-2H |
| InChIKey | HZXZOOPVQZMTBM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|