C9H2F14O — CID 155670558
3,3,4,4,5-pentafluoro-5-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxycyclopentene (PubChem CID 155670558) has the molecular formula C9H2F14O and a molecular weight of 392.09 g/mol. Its IUPAC name is 3,3,4,4,5-pentafluoro-5-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxycyclopentene.
| Compound Name | 3,3,4,4,5-pentafluoro-5-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxycyclopentene |
|---|---|
| PubChem CID | 155670558 |
| Molecular Formula | C9H2F14O |
| Molecular Weight | 392.09 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 3,3,4,4,5-pentafluoro-5-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxycyclopentene |
| SMILES | FC(F)(F)C(OC1(F)C=CC(F)(F)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H2F14O/c10-3(11)1-2-4(12,6(3,13)14)24-5(7(15,16)17,8(18,19)20)9(21,22)23/h1-2H |
| InChIKey | UGMRJEBKWNFXJC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.09 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|