C15H3F25O — CID 151074158
3,4,4,5,5,6-hexafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)cyclohexene (PubChem CID 151074158) has the molecular formula C15H3F25O and a molecular weight of 674.14 g/mol. Its IUPAC name is 3,4,4,5,5,6-hexafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)cyclohexene.
| Compound Name | 3,4,4,5,5,6-hexafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)cyclohexene |
|---|---|
| PubChem CID | 151074158 |
| Molecular Formula | C15H3F25O |
| Molecular Weight | 674.14 g/mol |
| Exact Mass | 673.98 |
| IUPAC Name | 3,4,4,5,5,6-hexafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)cyclohexene |
| SMILES | FC1C=CC(F)(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H3F25O/c16-3-1-2-4(17,6(20,21)5(3,18)19)41-15(39,40)13(34,35)11(30,31)9(26,27)7(22,23)8(24,25)10(28,29)12(32,33)14(36,37)38/h1-3H |
| InChIKey | MITDVFSGWNJKNH-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.14 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|