C12H8F10O — CID 124934393
(1R,2R,4S,5R,6R)-3,3,4-trifluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)tricyclo[4.2.1.02,5]non-7-ene (PubChem CID 124934393) has the molecular formula C12H8F10O and a molecular weight of 358.18 g/mol. Its IUPAC name is (1R,2R,4S,5R,6R)-3,3,4-trifluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)tricyclo[4.2.1.02,5]non-7-ene.
| Compound Name | (1R,2R,4S,5R,6R)-3,3,4-trifluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)tricyclo[4.2.1.02,5]non-7-ene |
|---|---|
| PubChem CID | 124934393 |
| Molecular Formula | C12H8F10O |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (1R,2R,4S,5R,6R)-3,3,4-trifluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)tricyclo[4.2.1.02,5]non-7-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)O[C@]1(F)[C@H]2[C@@H]([C@H]3C=C[C@H]2C3)C1(F)F |
| InChI | InChI=1S/C12H8F10O/c13-8(14)6-4-1-2-5(3-4)7(6)9(8,15)23-12(21,22)10(16,17)11(18,19)20/h1-2,4-7H,3H2/t4-,5-,6+,7+,9+/m0/s1 |
| InChIKey | NGEYGRCDNBGSKG-AJDRIWCOSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|