C11H10F6O — CID 123655038
3,3,4-trifluoro-4-(2,2,2-trifluoroethoxy)tricyclo[4.2.1.02,5]non-7-ene (PubChem CID 123655038) has the molecular formula C11H10F6O and a molecular weight of 272.19 g/mol. Its IUPAC name is 3,3,4-trifluoro-4-(2,2,2-trifluoroethoxy)tricyclo[4.2.1.02,5]non-7-ene.
| Compound Name | 3,3,4-trifluoro-4-(2,2,2-trifluoroethoxy)tricyclo[4.2.1.02,5]non-7-ene |
|---|---|
| PubChem CID | 123655038 |
| Molecular Formula | C11H10F6O |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3,3,4-trifluoro-4-(2,2,2-trifluoroethoxy)tricyclo[4.2.1.02,5]non-7-ene |
| SMILES | FC(F)(F)COC1(F)C2C3C=CC(C3)C2C1(F)F |
| InChI | InChI=1S/C11H10F6O/c12-9(13,14)4-18-11(17)8-6-2-1-5(3-6)7(8)10(11,15)16/h1-2,5-8H,3-4H2 |
| InChIKey | XJPOUNHWVVBKMA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|