C9H5F11O2 — CID 155670568
1,3,3,4,4-pentafluoro-5,5-bis(2,2,2-trifluoroethoxy)cyclopentene (PubChem CID 155670568) has the molecular formula C9H5F11O2 and a molecular weight of 354.12 g/mol. Its IUPAC name is 1,3,3,4,4-pentafluoro-5,5-bis(2,2,2-trifluoroethoxy)cyclopentene.
| Compound Name | 1,3,3,4,4-pentafluoro-5,5-bis(2,2,2-trifluoroethoxy)cyclopentene |
|---|---|
| PubChem CID | 155670568 |
| Molecular Formula | C9H5F11O2 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 1,3,3,4,4-pentafluoro-5,5-bis(2,2,2-trifluoroethoxy)cyclopentene |
| SMILES | FC1=CC(F)(F)C(F)(F)C1(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C9H5F11O2/c10-4-1-5(11,12)9(19,20)8(4,21-2-6(13,14)15)22-3-7(16,17)18/h1H,2-3H2 |
| InChIKey | BAXNCTYRLOHSIC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|