C9H6BrF5O — CID 118975363
2-(bromomethyl)-1,3-difluoro-5-(2,2,2-trifluoroethoxy)benzene (PubChem CID 118975363) has the molecular formula C9H6BrF5O and a molecular weight of 305.04 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-difluoro-5-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 2-(bromomethyl)-1,3-difluoro-5-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 118975363 |
| Molecular Formula | C9H6BrF5O |
| Molecular Weight | 305.04 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | 2-(bromomethyl)-1,3-difluoro-5-(2,2,2-trifluoroethoxy)benzene |
| SMILES | Fc1cc(OCC(F)(F)F)cc(F)c1CBr |
| InChI | InChI=1S/C9H6BrF5O/c10-3-6-7(11)1-5(2-8(6)12)16-4-9(13,14)15/h1-2H,3-4H2 |
| InChIKey | AMBMNZRARZNDTQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.04 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|