C11H14ClF3O — CID 155737841
1-chloro-3-methyl-5-(2,2,2-trifluoroethoxy)benzene;ethane (PubChem CID 155737841) has the molecular formula C11H14ClF3O and a molecular weight of 254.68 g/mol. Its IUPAC name is 1-chloro-3-methyl-5-(2,2,2-trifluoroethoxy)benzene;ethane.
| Compound Name | 1-chloro-3-methyl-5-(2,2,2-trifluoroethoxy)benzene;ethane |
|---|---|
| PubChem CID | 155737841 |
| Molecular Formula | C11H14ClF3O |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-chloro-3-methyl-5-(2,2,2-trifluoroethoxy)benzene;ethane |
| SMILES | CC.Cc1cc(Cl)cc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H8ClF3O.C2H6/c1-6-2-7(10)4-8(3-6)14-5-9(11,12)13;1-2/h2-4H,5H2,1H3;1-2H3 |
| InChIKey | WSNFDKQENNWOEJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |