C11H13F3O4S — CID 118084192
[3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]methyl methanesulfonate (PubChem CID 118084192) has the molecular formula C11H13F3O4S and a molecular weight of 298.28 g/mol. Its IUPAC name is [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]methyl methanesulfonate.
| Compound Name | [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 118084192 |
| Molecular Formula | C11H13F3O4S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]methyl methanesulfonate |
| SMILES | Cc1cc(COS(C)(=O)=O)cc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3O4S/c1-8-3-9(6-18-19(2,15)16)5-10(4-8)17-7-11(12,13)14/h3-5H,6-7H2,1-2H3 |
| InChIKey | YACVQUZHMUZUAK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|