C17H15F6NO4S — CID 22203485
N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-methylbenzenesulfonamide (PubChem CID 22203485) has the molecular formula C17H15F6NO4S and a molecular weight of 443.37 g/mol. Its IUPAC name is N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 22203485 |
| Molecular Formula | C17H15F6NO4S |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H15F6NO4S/c1-11-2-4-15(5-3-11)29(25,26)24-12-6-13(27-9-16(18,19)20)8-14(7-12)28-10-17(21,22)23/h2-8,24H,9-10H2,1H3 |
| InChIKey | UUBYLVAWFGXPEP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |