C17H14F7NO4S — CID 22203437
N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]benzenesulfonamide (PubChem CID 22203437) has the molecular formula C17H14F7NO4S and a molecular weight of 461.36 g/mol. Its IUPAC name is N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]benzenesulfonamide.
| Compound Name | N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22203437 |
| Molecular Formula | C17H14F7NO4S |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(OCC(F)(F)F)cc(OCC(F)(F)C(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C17H14F7NO4S/c18-15(19)16(20,21)9-28-12-6-11(7-13(8-12)29-10-17(22,23)24)25-30(26,27)14-4-2-1-3-5-14/h1-8,15,25H,9-10H2 |
| InChIKey | IYUZTPSGXCDEFE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|