C24H22F3NO3S — CID 175149396
N-[3-[(E)-5-phenoxypent-1-enyl]-4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 175149396) has the molecular formula C24H22F3NO3S and a molecular weight of 461.51 g/mol. Its IUPAC name is N-[3-[(E)-5-phenoxypent-1-enyl]-4-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | N-[3-[(E)-5-phenoxypent-1-enyl]-4-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175149396 |
| Molecular Formula | C24H22F3NO3S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[3-[(E)-5-phenoxypent-1-enyl]-4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(C(F)(F)F)c(/C=C/CCCOc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H22F3NO3S/c25-24(26,27)23-16-15-20(28-32(29,30)22-13-7-2-8-14-22)18-19(23)10-4-3-9-17-31-21-11-5-1-6-12-21/h1-2,4-8,10-16,18,28H,3,9,17H2/b10-4+ |
| InChIKey | JJOCKBLQCBASEO-ONNFQVAWSA-N |
| XLogP | 6.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|