C8H7Cl2F3O3S — CID 87396424
sulfuryl dichloride;2,2,2-trifluoroethoxybenzene (PubChem CID 87396424) has the molecular formula C8H7Cl2F3O3S and a molecular weight of 311.11 g/mol. Its IUPAC name is sulfuryl dichloride;2,2,2-trifluoroethoxybenzene.
| Compound Name | sulfuryl dichloride;2,2,2-trifluoroethoxybenzene |
|---|---|
| PubChem CID | 87396424 |
| Molecular Formula | C8H7Cl2F3O3S |
| Molecular Weight | 311.11 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | sulfuryl dichloride;2,2,2-trifluoroethoxybenzene |
| SMILES | FC(F)(F)COc1ccccc1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C8H7F3O.Cl2O2S/c9-8(10,11)6-12-7-4-2-1-3-5-7;1-5(2,3)4/h1-5H,6H2; |
| InChIKey | OBCLNPFENNQLIL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.11 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |