C8H6F4O4S — CID 146049120
1-fluorosulfonyloxy-4-(2,2,2-trifluoroethoxy)benzene (PubChem CID 146049120) has the molecular formula C8H6F4O4S and a molecular weight of 274.19 g/mol. Its IUPAC name is 1-fluorosulfonyloxy-4-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1-fluorosulfonyloxy-4-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 146049120 |
| Molecular Formula | C8H6F4O4S |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 1-fluorosulfonyloxy-4-(2,2,2-trifluoroethoxy)benzene |
| SMILES | O=S(=O)(F)Oc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H6F4O4S/c9-8(10,11)5-15-6-1-3-7(4-2-6)16-17(12,13)14/h1-4H,5H2 |
| InChIKey | DMYQSIWSDFYXSG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |