C6H4F2O6S2 — CID 118561819
1,4-bis(fluorosulfonyloxy)benzene (PubChem CID 118561819) has the molecular formula C6H4F2O6S2 and a molecular weight of 274.22 g/mol. Its IUPAC name is 1,4-bis(fluorosulfonyloxy)benzene.
| Compound Name | 1,4-bis(fluorosulfonyloxy)benzene |
|---|---|
| PubChem CID | 118561819 |
| Molecular Formula | C6H4F2O6S2 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 273.94 |
| IUPAC Name | 1,4-bis(fluorosulfonyloxy)benzene |
| SMILES | O=S(=O)(F)Oc1ccc(OS(=O)(=O)F)cc1 |
| InChI | InChI=1S/C6H4F2O6S2/c7-15(9,10)13-5-1-2-6(4-3-5)14-16(8,11)12/h1-4H |
| InChIKey | OEJXDBMJMKHHMQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |