3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride

C6H3F3O8S3 — CID 165389057

IUPAC3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride
SMILESO=S(=O)(F)Oc1cc(OS(=O)(=O)F)cc(S(=O)(=O)F)c1
InChIInChI=1S/C6H3F3O8S3/c7-18(10,11)6-2-4(16-19(8,12)13)1-5(3-6)17-20(9,14)15/h1-3H
InChIKeyUXMKGRUTWATVLF-UHFFFAOYSA-N
MW356.28 g/mol
LogP0.53
Rot. Bonds5

About 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride

3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride (PubChem CID 165389057) has the molecular formula C6H3F3O8S3 and a molecular weight of 356.28 g/mol. Its IUPAC name is 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride.

Molecular Properties

Compound Name3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride
PubChem CID165389057
Molecular FormulaC6H3F3O8S3
Molecular Weight356.28 g/mol
Exact Mass355.89
IUPAC Name3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride
SMILESO=S(=O)(F)Oc1cc(OS(=O)(=O)F)cc(S(=O)(=O)F)c1
InChIInChI=1S/C6H3F3O8S3/c7-18(10,11)6-2-4(16-19(8,12)13)1-5(3-6)17-20(9,14)15/h1-3H
InChIKeyUXMKGRUTWATVLF-UHFFFAOYSA-N
XLogP0.53
TPSA120.88 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500356.28
LogP ≤ 50.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Analyze 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride?
The IUPAC name of 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride (CID 165389057) is 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride.
What is the SMILES notation for 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride?
The canonical SMILES for 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride is O=S(=O)(F)Oc1cc(OS(=O)(=O)F)cc(S(=O)(=O)F)c1.
What is the InChIKey of 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride?
The InChIKey is UXMKGRUTWATVLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3O8S3/c7-18(10,11)6-2-4(16-19(8,12)13)1-5(3-6)17-20(9,14)15/h1-3H.
What are the key properties of 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride?
3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride has a molecular weight of 356.28 g/mol, XLogP of 0.53, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride is sourced from PubChem (CID 165389057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).