C6H3F3O8S3 — CID 165389057
3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride (PubChem CID 165389057) has the molecular formula C6H3F3O8S3 and a molecular weight of 356.28 g/mol. Its IUPAC name is 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride.
| Compound Name | 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 165389057 |
| Molecular Formula | C6H3F3O8S3 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 355.89 |
| IUPAC Name | 3,5-bis(fluorosulfonyloxy)benzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)Oc1cc(OS(=O)(=O)F)cc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C6H3F3O8S3/c7-18(10,11)6-2-4(16-19(8,12)13)1-5(3-6)17-20(9,14)15/h1-3H |
| InChIKey | UXMKGRUTWATVLF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |