About [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite
[4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite (PubChem CID 129034652) has the molecular formula C14H10FO6S2-
and a molecular weight of 357.36 g/mol. Its IUPAC name is [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite.
Molecular Properties
| Compound Name | [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite |
| PubChem CID | 129034652 |
| Molecular Formula | C14H10FO6S2- |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite |
| SMILES | O=S([O-])Oc1ccc(/C=C/c2ccc(OS(=O)(=O)F)cc2)cc1 |
| InChI | InChI=1S/C14H11FO6S2/c15-23(18,19)21-14-9-5-12(6-10-14)2-1-11-3-7-13(8-4-11)20-22(16)17/h1-10H,(H,16,17)/p-1/b2-1+ |
| InChIKey | LLRBOIWURNXLFR-OWOJBTEDSA-M |
| XLogP | 2.62 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite?
The IUPAC name of [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite (CID 129034652) is [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite.
What is the SMILES notation for [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite?
The canonical SMILES for [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite is O=S([O-])Oc1ccc(/C=C/c2ccc(OS(=O)(=O)F)cc2)cc1.
What is the InChIKey of [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite?
The InChIKey is LLRBOIWURNXLFR-OWOJBTEDSA-M. The full InChI is InChI=1S/C14H11FO6S2/c15-23(18,19)21-14-9-5-12(6-10-14)2-1-11-3-7-13(8-4-11)20-22(16)17/h1-10H,(H,16,17)/p-1/b2-1+.
What are the key properties of [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite?
[4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite has a molecular weight of 357.36 g/mol, XLogP of 2.62, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-2-(4-fluorosulfonyloxyphenyl)ethenyl]phenyl] sulfite is sourced from PubChem (CID 129034652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).