C9H9BrF3NO3S — CID 83084147
1-bromo-N-[4-(2,2,2-trifluoroethoxy)phenyl]methanesulfonamide (PubChem CID 83084147) has the molecular formula C9H9BrF3NO3S and a molecular weight of 348.14 g/mol. Its IUPAC name is 1-bromo-N-[4-(2,2,2-trifluoroethoxy)phenyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[4-(2,2,2-trifluoroethoxy)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 83084147 |
| Molecular Formula | C9H9BrF3NO3S |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 1-bromo-N-[4-(2,2,2-trifluoroethoxy)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(CBr)Nc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9BrF3NO3S/c10-6-18(15,16)14-7-1-3-8(4-2-7)17-5-9(11,12)13/h1-4,14H,5-6H2 |
| InChIKey | YEAYZQZPKVSLBY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|