C11H12F3NO — CID 103438948
N-cyclopropyl-4-(2,2,2-trifluoroethoxy)aniline (PubChem CID 103438948) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is N-cyclopropyl-4-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | N-cyclopropyl-4-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 103438948 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-cyclopropyl-4-(2,2,2-trifluoroethoxy)aniline |
| SMILES | FC(F)(F)COc1ccc(NC2CC2)cc1 |
| InChI | InChI=1S/C11H12F3NO/c12-11(13,14)7-16-10-5-3-9(4-6-10)15-8-1-2-8/h3-6,8,15H,1-2,7H2 |
| InChIKey | LDKBGZNSDXLKBQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|