C14H18F3NO — CID 43686729
N-cyclohexyl-4-(2,2,2-trifluoroethoxy)aniline (PubChem CID 43686729) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | N-cyclohexyl-4-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 43686729 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-cyclohexyl-4-(2,2,2-trifluoroethoxy)aniline |
| SMILES | FC(F)(F)COc1ccc(NC2CCCCC2)cc1 |
| InChI | InChI=1S/C14H18F3NO/c15-14(16,17)10-19-13-8-6-12(7-9-13)18-11-4-2-1-3-5-11/h6-9,11,18H,1-5,10H2 |
| InChIKey | YXPBMFZIAPZUCU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|