About (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one
(3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one (PubChem CID 51982995) has the molecular formula C14H17F3N2O2
and a molecular weight of 302.30 g/mol. Its IUPAC name is (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one.
Molecular Properties
| Compound Name | (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one |
| PubChem CID | 51982995 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one |
| SMILES | O=C1NCCCC[C@H]1Nc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2O2/c15-14(16,17)9-21-11-6-4-10(5-7-11)19-12-3-1-2-8-18-13(12)20/h4-7,12,19H,1-3,8-9H2,(H,18,20)/t12-/m1/s1 |
| InChIKey | ZRRCWMSLWXFOFJ-GFCCVEGCSA-N |
| XLogP | 2.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one?
The IUPAC name of (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one (CID 51982995) is (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one.
What is the SMILES notation for (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one?
The canonical SMILES for (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one is O=C1NCCCC[C@H]1Nc1ccc(OCC(F)(F)F)cc1.
What is the InChIKey of (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one?
The InChIKey is ZRRCWMSLWXFOFJ-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H17F3N2O2/c15-14(16,17)9-21-11-6-4-10(5-7-11)19-12-3-1-2-8-18-13(12)20/h4-7,12,19H,1-3,8-9H2,(H,18,20)/t12-/m1/s1.
What are the key properties of (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one?
(3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one has a molecular weight of 302.30 g/mol, XLogP of 2.71, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[4-(2,2,2-trifluoroethoxy)anilino]azepan-2-one is sourced from PubChem (CID 51982995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).