C14H19Cl2F5N2O — CID 141036211
N-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperidin-4-amine;dihydrochloride (PubChem CID 141036211) has the molecular formula C14H19Cl2F5N2O and a molecular weight of 397.22 g/mol. Its IUPAC name is N-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperidin-4-amine;dihydrochloride.
| Compound Name | N-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 141036211 |
| Molecular Formula | C14H19Cl2F5N2O |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)C(F)(F)COc1ccc(NC2CCNCC2)cc1 |
| InChI | InChI=1S/C14H17F5N2O.2ClH/c15-13(16,14(17,18)19)9-22-12-3-1-10(2-4-12)21-11-5-7-20-8-6-11;;/h1-4,11,20-21H,5-9H2;2*1H |
| InChIKey | FCYNILRXJBNVEG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|