C20H15F7N2O4S — CID 22203469
N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]quinoline-8-sulfonamide (PubChem CID 22203469) has the molecular formula C20H15F7N2O4S and a molecular weight of 512.40 g/mol. Its IUPAC name is N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 22203469 |
| Molecular Formula | C20H15F7N2O4S |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(OCC(F)(F)F)cc(OCC(F)(F)C(F)F)c1)c1cccc2cccnc12 |
| InChI | InChI=1S/C20H15F7N2O4S/c21-18(22)19(23,24)10-32-14-7-13(8-15(9-14)33-11-20(25,26)27)29-34(30,31)16-5-1-3-12-4-2-6-28-17(12)16/h1-9,18,29H,10-11H2 |
| InChIKey | VXLGOSJPPGOYAU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|