C19H17ClF7NO4S — CID 22203483
4-chloro-2,5-dimethyl-N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]benzenesulfonamide (PubChem CID 22203483) has the molecular formula C19H17ClF7NO4S and a molecular weight of 523.85 g/mol. Its IUPAC name is 4-chloro-2,5-dimethyl-N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-2,5-dimethyl-N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22203483 |
| Molecular Formula | C19H17ClF7NO4S |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | 4-chloro-2,5-dimethyl-N-[3-(2,2,3,3-tetrafluoropropoxy)-5-(2,2,2-trifluoroethoxy)phenyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)C(F)F)c2)c(C)cc1Cl |
| InChI | InChI=1S/C19H17ClF7NO4S/c1-10-4-16(11(2)3-15(10)20)33(29,30)28-12-5-13(31-8-18(23,24)17(21)22)7-14(6-12)32-9-19(25,26)27/h3-7,17,28H,8-9H2,1-2H3 |
| InChIKey | HTOCOJGXWOEPDF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|