About [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid
[3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid (PubChem CID 164886297) has the molecular formula C9H10BF3O3
and a molecular weight of 233.98 g/mol. Its IUPAC name is [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid.
Molecular Properties
| Compound Name | [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| PubChem CID | 164886297 |
| Molecular Formula | C9H10BF3O3 |
| Molecular Weight | 233.98 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| SMILES | Cc1cc(OCC(F)(F)F)cc(B(O)O)c1 |
| InChI | InChI=1S/C9H10BF3O3/c1-6-2-7(10(14)15)4-8(3-6)16-5-9(11,12)13/h2-4,14-15H,5H2,1H3 |
| InChIKey | WZWUDDXHCSHMSO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.98 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid?
The IUPAC name of [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid (CID 164886297) is [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid.
What is the SMILES notation for [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid?
The canonical SMILES for [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid is Cc1cc(OCC(F)(F)F)cc(B(O)O)c1.
What is the InChIKey of [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid?
The InChIKey is WZWUDDXHCSHMSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BF3O3/c1-6-2-7(10(14)15)4-8(3-6)16-5-9(11,12)13/h2-4,14-15H,5H2,1H3.
What are the key properties of [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid?
[3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid has a molecular weight of 233.98 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid is sourced from PubChem (CID 164886297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).