C8H7BF4O3 — CID 44717669
[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid (PubChem CID 44717669) has the molecular formula C8H7BF4O3 and a molecular weight of 237.94 g/mol. Its IUPAC name is [3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid.
| Compound Name | [3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 44717669 |
| Molecular Formula | C8H7BF4O3 |
| Molecular Weight | 237.94 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | [3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(OCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C8H7BF4O3/c10-6-3-5(9(14)15)1-2-7(6)16-4-8(11,12)13/h1-3,14-15H,4H2 |
| InChIKey | DPSYYQDRJMHAGP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.94 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|