C11H6F4N4O — CID 169340479
2-[[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169340479) has the molecular formula C11H6F4N4O and a molecular weight of 286.19 g/mol. Its IUPAC name is 2-[[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340479 |
| Molecular Formula | C11H6F4N4O |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-[[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccc(OCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H6F4N4O/c12-9-3-7(18-19-8(4-16)5-17)1-2-10(9)20-6-11(13,14)15/h1-3,18H,6H2 |
| InChIKey | IOSPZFKCKPYYOT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|