C13H13FN4O2 — CID 169340200
2-[[3-fluoro-4-(3-methoxypropoxy)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169340200) has the molecular formula C13H13FN4O2 and a molecular weight of 276.27 g/mol. Its IUPAC name is 2-[[3-fluoro-4-(3-methoxypropoxy)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[3-fluoro-4-(3-methoxypropoxy)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340200 |
| Molecular Formula | C13H13FN4O2 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[[3-fluoro-4-(3-methoxypropoxy)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | COCCCOc1ccc(NN=C(C#N)C#N)cc1F |
| InChI | InChI=1S/C13H13FN4O2/c1-19-5-2-6-20-13-4-3-10(7-12(13)14)17-18-11(8-15)9-16/h3-4,7,17H,2,5-6H2,1H3 |
| InChIKey | MKEXMRLZZNPNQG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|