C34H30BF6O2P — CID 175358027
[3,5-bis(2,2,2-trifluoroethoxy)phenyl]phosphanium;tetraphenylboranuide (PubChem CID 175358027) has the molecular formula C34H30BF6O2P and a molecular weight of 626.39 g/mol. Its IUPAC name is [3,5-bis(2,2,2-trifluoroethoxy)phenyl]phosphanium;tetraphenylboranuide.
| Compound Name | [3,5-bis(2,2,2-trifluoroethoxy)phenyl]phosphanium;tetraphenylboranuide |
|---|---|
| PubChem CID | 175358027 |
| Molecular Formula | C34H30BF6O2P |
| Molecular Weight | 626.39 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | [3,5-bis(2,2,2-trifluoroethoxy)phenyl]phosphanium;tetraphenylboranuide |
| SMILES | FC(F)(F)COc1cc([PH3+])cc(OCC(F)(F)F)c1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C10H9F6O2P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;11-9(12,13)4-17-6-1-7(3-8(19)2-6)18-5-10(14,15)16/h1-20H;1-3H,4-5,19H2/q-1;/p+1 |
| InChIKey | CLKQOUVADHTABN-UHFFFAOYSA-O |
| XLogP | 5.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.39 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|