C7H4BrF2I — CID 131263559
2-(bromomethyl)-1,3-difluoro-5-iodobenzene (PubChem CID 131263559) has the molecular formula C7H4BrF2I and a molecular weight of 332.91 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-difluoro-5-iodobenzene.
| Compound Name | 2-(bromomethyl)-1,3-difluoro-5-iodobenzene |
|---|---|
| PubChem CID | 131263559 |
| Molecular Formula | C7H4BrF2I |
| Molecular Weight | 332.91 g/mol |
| Exact Mass | 331.85 |
| IUPAC Name | 2-(bromomethyl)-1,3-difluoro-5-iodobenzene |
| SMILES | Fc1cc(I)cc(F)c1CBr |
| InChI | InChI=1S/C7H4BrF2I/c8-3-5-6(9)1-4(11)2-7(5)10/h1-2H,3H2 |
| InChIKey | HTZXDWWZDDAXCI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.91 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|