About 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene
1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene (PubChem CID 166444030) has the molecular formula C7H2BrF4I
and a molecular weight of 368.89 g/mol. Its IUPAC name is 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene.
Molecular Properties
| Compound Name | 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene |
| PubChem CID | 166444030 |
| Molecular Formula | C7H2BrF4I |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 367.83 |
| IUPAC Name | 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene |
| SMILES | Fc1c(F)c(F)c(CBr)c(I)c1F |
| InChI | InChI=1S/C7H2BrF4I/c8-1-2-3(9)4(10)5(11)6(12)7(2)13/h1H2 |
| InChIKey | GIBIRTMAKWXSOT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene?
The IUPAC name of 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene (CID 166444030) is 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene.
What is the SMILES notation for 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene?
The canonical SMILES for 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene is Fc1c(F)c(F)c(CBr)c(I)c1F.
What is the InChIKey of 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene?
The InChIKey is GIBIRTMAKWXSOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2BrF4I/c8-1-2-3(9)4(10)5(11)6(12)7(2)13/h1H2.
What are the key properties of 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene?
1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene has a molecular weight of 368.89 g/mol, XLogP of 3.74, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-2,3,4,5-tetrafluoro-6-iodobenzene is sourced from PubChem (CID 166444030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).