C7H5BrF4N+ — CID 131875199
[4-(bromomethyl)-2,3,5,6-tetrafluorophenyl]azanium (PubChem CID 131875199) has the molecular formula C7H5BrF4N+ and a molecular weight of 259.02 g/mol. Its IUPAC name is [4-(bromomethyl)-2,3,5,6-tetrafluorophenyl]azanium.
| Compound Name | [4-(bromomethyl)-2,3,5,6-tetrafluorophenyl]azanium |
|---|---|
| PubChem CID | 131875199 |
| Molecular Formula | C7H5BrF4N+ |
| Molecular Weight | 259.02 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | [4-(bromomethyl)-2,3,5,6-tetrafluorophenyl]azanium |
| SMILES | [NH3+]c1c(F)c(F)c(CBr)c(F)c1F |
| InChI | InChI=1S/C7H4BrF4N/c8-1-2-3(9)5(11)7(13)6(12)4(2)10/h1,13H2/p+1 |
| InChIKey | RPXYSLQGXZUZHU-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.02 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|