C14H16BrF3 — CID 174885593
1-(bromomethyl)-5-cyclohexyl-2,3,4-trifluoro-6-methylbenzene (PubChem CID 174885593) has the molecular formula C14H16BrF3 and a molecular weight of 321.18 g/mol. Its IUPAC name is 1-(bromomethyl)-5-cyclohexyl-2,3,4-trifluoro-6-methylbenzene.
| Compound Name | 1-(bromomethyl)-5-cyclohexyl-2,3,4-trifluoro-6-methylbenzene |
|---|---|
| PubChem CID | 174885593 |
| Molecular Formula | C14H16BrF3 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-(bromomethyl)-5-cyclohexyl-2,3,4-trifluoro-6-methylbenzene |
| SMILES | Cc1c(CBr)c(F)c(F)c(F)c1C1CCCCC1 |
| InChI | InChI=1S/C14H16BrF3/c1-8-10(7-15)12(16)14(18)13(17)11(8)9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
| InChIKey | LUBBNJWXQDDHAG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|